C27H32N2O6 — CID 55676683
ethyl 2-[3-[[1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]phenoxy]acetate (PubChem CID 55676683) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is ethyl 2-[3-[[1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]phenoxy]acetate.
| Compound Name | ethyl 2-[3-[[1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 55676683 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | ethyl 2-[3-[[1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cccc(NC(=O)C2CC3CCCCC3N2C(=O)c2ccccc2OC)c1 |
| InChI | InChI=1S/C27H32N2O6/c1-3-34-25(30)17-35-20-11-8-10-19(16-20)28-26(31)23-15-18-9-4-6-13-22(18)29(23)27(32)21-12-5-7-14-24(21)33-2/h5,7-8,10-12,14,16,18,22-23H,3-4,6,9,13,15,17H2,1-2H3,(H,28,31) |
| InChIKey | PAXMIBOZZAXSLG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |