C26H29FN2O5 — CID 47090980
ethyl 2-[3-[[1-(4-fluorobenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]phenoxy]acetate (PubChem CID 47090980) has the molecular formula C26H29FN2O5 and a molecular weight of 468.53 g/mol. Its IUPAC name is ethyl 2-[3-[[1-(4-fluorobenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]phenoxy]acetate.
| Compound Name | ethyl 2-[3-[[1-(4-fluorobenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 47090980 |
| Molecular Formula | C26H29FN2O5 |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | ethyl 2-[3-[[1-(4-fluorobenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cccc(NC(=O)C2CC3CCCCC3N2C(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C26H29FN2O5/c1-2-33-24(30)16-34-21-8-5-7-20(15-21)28-25(31)23-14-18-6-3-4-9-22(18)29(23)26(32)17-10-12-19(27)13-11-17/h5,7-8,10-13,15,18,22-23H,2-4,6,9,14,16H2,1H3,(H,28,31) |
| InChIKey | JBLCGVACXNLYHO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |