C24H23FN2O2 — CID 129418941
(2S,3aS,7aR)-N-(3-ethynylphenyl)-1-(4-fluorobenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 129418941) has the molecular formula C24H23FN2O2 and a molecular weight of 390.46 g/mol. Its IUPAC name is (2S,3aS,7aR)-N-(3-ethynylphenyl)-1-(4-fluorobenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | (2S,3aS,7aR)-N-(3-ethynylphenyl)-1-(4-fluorobenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 129418941 |
| Molecular Formula | C24H23FN2O2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (2S,3aS,7aR)-N-(3-ethynylphenyl)-1-(4-fluorobenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)[C@@H]2C[C@@H]3CCCC[C@H]3N2C(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C24H23FN2O2/c1-2-16-6-5-8-20(14-16)26-23(28)22-15-18-7-3-4-9-21(18)27(22)24(29)17-10-12-19(25)13-11-17/h1,5-6,8,10-14,18,21-22H,3-4,7,9,15H2,(H,26,28)/t18-,21+,22-/m0/s1 |
| InChIKey | HXGHCEBGUYFSPZ-BWAGFHJFSA-N |
| XLogP | 4.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|