C23H26N2O3 — CID 42958677
1-(2-methoxybenzoyl)-N-phenyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 42958677) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 1-(2-methoxybenzoyl)-N-phenyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | 1-(2-methoxybenzoyl)-N-phenyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 42958677 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1-(2-methoxybenzoyl)-N-phenyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | COc1ccccc1C(=O)N1C(C(=O)Nc2ccccc2)CC2CCCCC21 |
| InChI | InChI=1S/C23H26N2O3/c1-28-21-14-8-6-12-18(21)23(27)25-19-13-7-5-9-16(19)15-20(25)22(26)24-17-10-3-2-4-11-17/h2-4,6,8,10-12,14,16,19-20H,5,7,9,13,15H2,1H3,(H,24,26) |
| InChIKey | LCSYTSYKOPFRAB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |