C27H33N3O4 — CID 55645485
N-[2-(2-ethylanilino)-2-oxoethyl]-1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 55645485) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is N-[2-(2-ethylanilino)-2-oxoethyl]-1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | N-[2-(2-ethylanilino)-2-oxoethyl]-1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 55645485 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | N-[2-(2-ethylanilino)-2-oxoethyl]-1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | CCc1ccccc1NC(=O)CNC(=O)C1CC2CCCCC2N1C(=O)c1ccccc1OC |
| InChI | InChI=1S/C27H33N3O4/c1-3-18-10-4-7-13-21(18)29-25(31)17-28-26(32)23-16-19-11-5-8-14-22(19)30(23)27(33)20-12-6-9-15-24(20)34-2/h4,6-7,9-10,12-13,15,19,22-23H,3,5,8,11,14,16-17H2,1-2H3,(H,28,32)(H,29,31) |
| InChIKey | XVGXRYDXECKGFQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |