C23H24FN3O5 — CID 60528339
N-(2-fluoro-5-nitrophenyl)-1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 60528339) has the molecular formula C23H24FN3O5 and a molecular weight of 441.46 g/mol. Its IUPAC name is N-(2-fluoro-5-nitrophenyl)-1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | N-(2-fluoro-5-nitrophenyl)-1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 60528339 |
| Molecular Formula | C23H24FN3O5 |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-(2-fluoro-5-nitrophenyl)-1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | COc1ccccc1C(=O)N1C(C(=O)Nc2cc([N+](=O)[O-])ccc2F)CC2CCCCC21 |
| InChI | InChI=1S/C23H24FN3O5/c1-32-21-9-5-3-7-16(21)23(29)26-19-8-4-2-6-14(19)12-20(26)22(28)25-18-13-15(27(30)31)10-11-17(18)24/h3,5,7,9-11,13-14,19-20H,2,4,6,8,12H2,1H3,(H,25,28) |
| InChIKey | DBMGKWAPHCKXSW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|