C28H35N3O5 — CID 55676565
N-ethyl-N-[2-(3-methoxyanilino)-2-oxoethyl]-1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 55676565) has the molecular formula C28H35N3O5 and a molecular weight of 493.60 g/mol. Its IUPAC name is N-ethyl-N-[2-(3-methoxyanilino)-2-oxoethyl]-1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | N-ethyl-N-[2-(3-methoxyanilino)-2-oxoethyl]-1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 55676565 |
| Molecular Formula | C28H35N3O5 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | N-ethyl-N-[2-(3-methoxyanilino)-2-oxoethyl]-1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | CCN(CC(=O)Nc1cccc(OC)c1)C(=O)C1CC2CCCCC2N1C(=O)c1ccccc1OC |
| InChI | InChI=1S/C28H35N3O5/c1-4-30(18-26(32)29-20-11-9-12-21(17-20)35-2)28(34)24-16-19-10-5-7-14-23(19)31(24)27(33)22-13-6-8-15-25(22)36-3/h6,8-9,11-13,15,17,19,23-24H,4-5,7,10,14,16,18H2,1-3H3,(H,29,32) |
| InChIKey | CXDXMMJLNLNSEZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |