C19H26N2O4 — CID 129418894
methyl (2S,3aR,7aR)-1-[2-(3-methoxyanilino)-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 129418894) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is methyl (2S,3aR,7aR)-1-[2-(3-methoxyanilino)-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl (2S,3aR,7aR)-1-[2-(3-methoxyanilino)-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 129418894 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | methyl (2S,3aR,7aR)-1-[2-(3-methoxyanilino)-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H]2CCCC[C@H]2N1CC(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C19H26N2O4/c1-24-15-8-5-7-14(11-15)20-18(22)12-21-16-9-4-3-6-13(16)10-17(21)19(23)25-2/h5,7-8,11,13,16-17H,3-4,6,9-10,12H2,1-2H3,(H,20,22)/t13-,16-,17+/m1/s1 |
| InChIKey | CJWCFCJZCQSCLW-XYPHTWIQSA-N |
| XLogP | 2.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |