C18H25N3O2S — CID 124792441
(2S,3aR,7aR)-1-[2-(3-methylsulfanylanilino)-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 124792441) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is (2S,3aR,7aR)-1-[2-(3-methylsulfanylanilino)-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | (2S,3aR,7aR)-1-[2-(3-methylsulfanylanilino)-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 124792441 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (2S,3aR,7aR)-1-[2-(3-methylsulfanylanilino)-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | CSc1cccc(NC(=O)CN2[C@@H]3CCCC[C@@H]3C[C@H]2C(N)=O)c1 |
| InChI | InChI=1S/C18H25N3O2S/c1-24-14-7-4-6-13(10-14)20-17(22)11-21-15-8-3-2-5-12(15)9-16(21)18(19)23/h4,6-7,10,12,15-16H,2-3,5,8-9,11H2,1H3,(H2,19,23)(H,20,22)/t12-,15-,16+/m1/s1 |
| InChIKey | SLGKSFARSXRTQW-WQVCFCJDSA-N |
| XLogP | 2.47 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |