C18H21ClF3N3O2 — CID 100854144
(2S,3aS,7aS)-1-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 100854144) has the molecular formula C18H21ClF3N3O2 and a molecular weight of 403.83 g/mol. Its IUPAC name is (2S,3aS,7aS)-1-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | (2S,3aS,7aS)-1-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 100854144 |
| Molecular Formula | C18H21ClF3N3O2 |
| Molecular Weight | 403.83 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | (2S,3aS,7aS)-1-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | NC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2N1CC(=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C18H21ClF3N3O2/c19-11-5-6-13(12(8-11)18(20,21)22)24-16(26)9-25-14-4-2-1-3-10(14)7-15(25)17(23)27/h5-6,8,10,14-15H,1-4,7,9H2,(H2,23,27)(H,24,26)/t10-,14-,15-/m0/s1 |
| InChIKey | YSLBWRPUMNMGPC-LKTVYLICSA-N |
| XLogP | 3.42 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.83 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |