C18H17ClF3N3O — CID 97076693
N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[(2R)-2-pyridin-4-ylpyrrolidin-1-yl]acetamide (PubChem CID 97076693) has the molecular formula C18H17ClF3N3O and a molecular weight of 383.80 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[(2R)-2-pyridin-4-ylpyrrolidin-1-yl]acetamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[(2R)-2-pyridin-4-ylpyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 97076693 |
| Molecular Formula | C18H17ClF3N3O |
| Molecular Weight | 383.80 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[(2R)-2-pyridin-4-ylpyrrolidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC[C@@H]1c1ccncc1)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C18H17ClF3N3O/c19-13-3-4-15(14(10-13)18(20,21)22)24-17(26)11-25-9-1-2-16(25)12-5-7-23-8-6-12/h3-8,10,16H,1-2,9,11H2,(H,24,26)/t16-/m1/s1 |
| InChIKey | OAHDXFJUHWCCON-MRXNPFEDSA-N |
| XLogP | 4.53 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.80 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |