C17H17ClF3N3O3 — CID 2449682
N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 2449682) has the molecular formula C17H17ClF3N3O3 and a molecular weight of 403.79 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 2449682 |
| Molecular Formula | C17H17ClF3N3O3 |
| Molecular Weight | 403.79 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCCCC2)C1=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C17H17ClF3N3O3/c18-10-4-5-12(11(8-10)17(19,20)21)22-13(25)9-24-14(26)16(23-15(24)27)6-2-1-3-7-16/h4-5,8H,1-3,6-7,9H2,(H,22,25)(H,23,27) |
| InChIKey | KYQFDFOPADIINE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.79 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|