C15H15ClF3N5OS — CID 27094013
N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(1-cyclopentyltetrazol-5-yl)sulfanylacetamide (PubChem CID 27094013) has the molecular formula C15H15ClF3N5OS and a molecular weight of 405.83 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(1-cyclopentyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(1-cyclopentyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 27094013 |
| Molecular Formula | C15H15ClF3N5OS |
| Molecular Weight | 405.83 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(1-cyclopentyltetrazol-5-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1C1CCCC1)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C15H15ClF3N5OS/c16-9-5-6-12(11(7-9)15(17,18)19)20-13(25)8-26-14-21-22-23-24(14)10-3-1-2-4-10/h5-7,10H,1-4,8H2,(H,20,25) |
| InChIKey | KQVXQZACEXKYKJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.83 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |