C27H26N6O2 — CID 170265609
(2S,3aR,7aR)-1-(naphthalene-2-carbonyl)-N-[3-(2H-tetrazol-5-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 170265609) has the molecular formula C27H26N6O2 and a molecular weight of 466.55 g/mol. Its IUPAC name is (2S,3aR,7aR)-1-(naphthalene-2-carbonyl)-N-[3-(2H-tetrazol-5-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | (2S,3aR,7aR)-1-(naphthalene-2-carbonyl)-N-[3-(2H-tetrazol-5-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 170265609 |
| Molecular Formula | C27H26N6O2 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | (2S,3aR,7aR)-1-(naphthalene-2-carbonyl)-N-[3-(2H-tetrazol-5-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | O=C(Nc1cccc(-c2nn[nH]n2)c1)[C@@H]1C[C@H]2CCCC[C@H]2N1C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H26N6O2/c34-26(28-22-10-5-9-20(15-22)25-29-31-32-30-25)24-16-19-8-3-4-11-23(19)33(24)27(35)21-13-12-17-6-1-2-7-18(17)14-21/h1-2,5-7,9-10,12-15,19,23-24H,3-4,8,11,16H2,(H,28,34)(H,29,30,31,32)/t19-,23-,24+/m1/s1 |
| InChIKey | WCUOYAKPKZQGSJ-FOVJLYNBSA-N |
| XLogP | 4.43 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |