C24H25ClN6O2S — CID 56510321
1-(3-chlorobenzoyl)-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 56510321) has the molecular formula C24H25ClN6O2S and a molecular weight of 497.02 g/mol. Its IUPAC name is 1-(3-chlorobenzoyl)-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | 1-(3-chlorobenzoyl)-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 56510321 |
| Molecular Formula | C24H25ClN6O2S |
| Molecular Weight | 497.02 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 1-(3-chlorobenzoyl)-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | CSc1nnnn1-c1cccc(NC(=O)C2CC3CCCCC3N2C(=O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C24H25ClN6O2S/c1-34-24-27-28-29-31(24)19-10-5-9-18(14-19)26-22(32)21-13-15-6-2-3-11-20(15)30(21)23(33)16-7-4-8-17(25)12-16/h4-5,7-10,12,14-15,20-21H,2-3,6,11,13H2,1H3,(H,26,32) |
| InChIKey | SBEZLTASLVBYQA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.02 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |