C24H32ClN3O2 — CID 119506894
N-[2-(ethylamino)ethyl]-1-(naphthalene-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide;hydrochloride (PubChem CID 119506894) has the molecular formula C24H32ClN3O2 and a molecular weight of 429.99 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-1-(naphthalene-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-1-(naphthalene-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119506894 |
| Molecular Formula | C24H32ClN3O2 |
| Molecular Weight | 429.99 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-1-(naphthalene-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide;hydrochloride |
| SMILES | CCNCCNC(=O)C1CC2CCCCC2N1C(=O)c1ccc2ccccc2c1.Cl |
| InChI | InChI=1S/C24H31N3O2.ClH/c1-2-25-13-14-26-23(28)22-16-19-9-5-6-10-21(19)27(22)24(29)20-12-11-17-7-3-4-8-18(17)15-20;/h3-4,7-8,11-12,15,19,21-22,25H,2,5-6,9-10,13-14,16H2,1H3,(H,26,28);1H |
| InChIKey | GWWZJTQLCFMPAK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.99 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|