C23H26N2O4 — CID 119348761
2-[[1-(naphthalene-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]propanoic acid (PubChem CID 119348761) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is 2-[[1-(naphthalene-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]propanoic acid.
| Compound Name | 2-[[1-(naphthalene-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119348761 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 2-[[1-(naphthalene-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C1CC2CCCCC2N1C(=O)c1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C23H26N2O4/c1-14(23(28)29)24-21(26)20-13-17-8-4-5-9-19(17)25(20)22(27)18-11-10-15-6-2-3-7-16(15)12-18/h2-3,6-7,10-12,14,17,19-20H,4-5,8-9,13H2,1H3,(H,24,26)(H,28,29) |
| InChIKey | LJBFPXMRFVDJLV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |