C32H30ClN3O5S — CID 166374029
(2S,3aS,7aS)-N-[5-[(2-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-1-(naphthalene-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 166374029) has the molecular formula C32H30ClN3O5S and a molecular weight of 604.13 g/mol. Its IUPAC name is (2S,3aS,7aS)-N-[5-[(2-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-1-(naphthalene-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | (2S,3aS,7aS)-N-[5-[(2-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-1-(naphthalene-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 166374029 |
| Molecular Formula | C32H30ClN3O5S |
| Molecular Weight | 604.13 g/mol |
| Exact Mass | 603.16 |
| IUPAC Name | (2S,3aS,7aS)-N-[5-[(2-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-1-(naphthalene-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)Nc2ccccc2Cl)ccc1O)[C@@H]1C[C@@H]2CCCC[C@@H]2N1C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C32H30ClN3O5S/c33-25-10-4-5-11-26(25)35-42(40,41)24-15-16-30(37)27(19-24)34-31(38)29-18-22-9-3-6-12-28(22)36(29)32(39)23-14-13-20-7-1-2-8-21(20)17-23/h1-2,4-5,7-8,10-11,13-17,19,22,28-29,35,37H,3,6,9,12,18H2,(H,34,38)/t22-,28-,29-/m0/s1 |
| InChIKey | JMCOWHGMXLFGMZ-ZRKWFTTGSA-N |
| XLogP | 6.41 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.13 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|