C13H9ClKNO5S — CID 23670809
potassium 5-[(2-chlorophenyl)sulfamoyl]-2-hydroxybenzoate (PubChem CID 23670809) has the molecular formula C13H9ClKNO5S and a molecular weight of 365.84 g/mol. Its IUPAC name is potassium 5-[(2-chlorophenyl)sulfamoyl]-2-hydroxybenzoate.
| Compound Name | potassium 5-[(2-chlorophenyl)sulfamoyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 23670809 |
| Molecular Formula | C13H9ClKNO5S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 364.95 |
| IUPAC Name | potassium 5-[(2-chlorophenyl)sulfamoyl]-2-hydroxybenzoate |
| SMILES | O=C([O-])c1cc(S(=O)(=O)Nc2ccccc2Cl)ccc1O.[K+] |
| InChI | InChI=1S/C13H10ClNO5S.K/c14-10-3-1-2-4-11(10)15-21(19,20)8-5-6-12(16)9(7-8)13(17)18;/h1-7,15-16H,(H,17,18);/q;+1/p-1 |
| InChIKey | RYWVGRGGGRFTTD-UHFFFAOYSA-M |
| XLogP | -1.79 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |