C14H13ClN2O4S — CID 22719116
N-[4-(benzenesulfonamido)-2-chloro-5-hydroxyphenyl]acetamide (PubChem CID 22719116) has the molecular formula C14H13ClN2O4S and a molecular weight of 340.79 g/mol. Its IUPAC name is N-[4-(benzenesulfonamido)-2-chloro-5-hydroxyphenyl]acetamide.
| Compound Name | N-[4-(benzenesulfonamido)-2-chloro-5-hydroxyphenyl]acetamide |
|---|---|
| PubChem CID | 22719116 |
| Molecular Formula | C14H13ClN2O4S |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | N-[4-(benzenesulfonamido)-2-chloro-5-hydroxyphenyl]acetamide |
| SMILES | CC(=O)Nc1cc(O)c(NS(=O)(=O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C14H13ClN2O4S/c1-9(18)16-12-8-14(19)13(7-11(12)15)17-22(20,21)10-5-3-2-4-6-10/h2-8,17,19H,1H3,(H,16,18) |
| InChIKey | YQSIQCQVIMTESG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|