C14H12Cl2N2O4S — CID 22719120
N-[4-(benzenesulfonamido)-2,6-dichloro-3-hydroxyphenyl]acetamide (PubChem CID 22719120) has the molecular formula C14H12Cl2N2O4S and a molecular weight of 375.23 g/mol. Its IUPAC name is N-[4-(benzenesulfonamido)-2,6-dichloro-3-hydroxyphenyl]acetamide.
| Compound Name | N-[4-(benzenesulfonamido)-2,6-dichloro-3-hydroxyphenyl]acetamide |
|---|---|
| PubChem CID | 22719120 |
| Molecular Formula | C14H12Cl2N2O4S |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | N-[4-(benzenesulfonamido)-2,6-dichloro-3-hydroxyphenyl]acetamide |
| SMILES | CC(=O)Nc1c(Cl)cc(NS(=O)(=O)c2ccccc2)c(O)c1Cl |
| InChI | InChI=1S/C14H12Cl2N2O4S/c1-8(19)17-13-10(15)7-11(14(20)12(13)16)18-23(21,22)9-5-3-2-4-6-9/h2-7,18,20H,1H3,(H,17,19) |
| InChIKey | WUNPEJNCVUGVFQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|