About N-[2,6-dichloro-3-hydroxy-4-(methanesulfonamido)phenyl]acetamide
N-[2,6-dichloro-3-hydroxy-4-(methanesulfonamido)phenyl]acetamide (PubChem CID 22719099) has the molecular formula C9H10Cl2N2O4S
and a molecular weight of 313.16 g/mol. Its IUPAC name is N-[2,6-dichloro-3-hydroxy-4-(methanesulfonamido)phenyl]acetamide.
Molecular Properties
| Compound Name | N-[2,6-dichloro-3-hydroxy-4-(methanesulfonamido)phenyl]acetamide |
| PubChem CID | 22719099 |
| Molecular Formula | C9H10Cl2N2O4S |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | N-[2,6-dichloro-3-hydroxy-4-(methanesulfonamido)phenyl]acetamide |
| SMILES | CC(=O)Nc1c(Cl)cc(NS(C)(=O)=O)c(O)c1Cl |
| InChI | InChI=1S/C9H10Cl2N2O4S/c1-4(14)12-8-5(10)3-6(9(15)7(8)11)13-18(2,16)17/h3,13,15H,1-2H3,(H,12,14) |
| InChIKey | IACBZRWAKBIIMY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze N-[2,6-dichloro-3-hydroxy-4-(methanesulfonamido)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,6-dichloro-3-hydroxy-4-(methanesulfonamido)phenyl]acetamide?
The IUPAC name of N-[2,6-dichloro-3-hydroxy-4-(methanesulfonamido)phenyl]acetamide (CID 22719099) is N-[2,6-dichloro-3-hydroxy-4-(methanesulfonamido)phenyl]acetamide.
What is the SMILES notation for N-[2,6-dichloro-3-hydroxy-4-(methanesulfonamido)phenyl]acetamide?
The canonical SMILES for N-[2,6-dichloro-3-hydroxy-4-(methanesulfonamido)phenyl]acetamide is CC(=O)Nc1c(Cl)cc(NS(C)(=O)=O)c(O)c1Cl.
What is the InChIKey of N-[2,6-dichloro-3-hydroxy-4-(methanesulfonamido)phenyl]acetamide?
The InChIKey is IACBZRWAKBIIMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Cl2N2O4S/c1-4(14)12-8-5(10)3-6(9(15)7(8)11)13-18(2,16)17/h3,13,15H,1-2H3,(H,12,14).
What are the key properties of N-[2,6-dichloro-3-hydroxy-4-(methanesulfonamido)phenyl]acetamide?
N-[2,6-dichloro-3-hydroxy-4-(methanesulfonamido)phenyl]acetamide has a molecular weight of 313.16 g/mol, XLogP of 2.03, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,6-dichloro-3-hydroxy-4-(methanesulfonamido)phenyl]acetamide is sourced from PubChem (CID 22719099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).