C9H10Cl2N2O4S — CID 22719099
N-[2,6-dichloro-3-hydroxy-4-(methanesulfonamido)phenyl]acetamide (PubChem CID 22719099) has the molecular formula C9H10Cl2N2O4S and a molecular weight of 313.16 g/mol. Its IUPAC name is N-[2,6-dichloro-3-hydroxy-4-(methanesulfonamido)phenyl]acetamide.
| Compound Name | N-[2,6-dichloro-3-hydroxy-4-(methanesulfonamido)phenyl]acetamide |
|---|---|
| PubChem CID | 22719099 |
| Molecular Formula | C9H10Cl2N2O4S |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | N-[2,6-dichloro-3-hydroxy-4-(methanesulfonamido)phenyl]acetamide |
| SMILES | CC(=O)Nc1c(Cl)cc(NS(C)(=O)=O)c(O)c1Cl |
| InChI | InChI=1S/C9H10Cl2N2O4S/c1-4(14)12-8-5(10)3-6(9(15)7(8)11)13-18(2,16)17/h3,13,15H,1-2H3,(H,12,14) |
| InChIKey | IACBZRWAKBIIMY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|