C9H8Cl3NO — CID 88800520
N-(2,3,4-trichloro-6-methylphenyl)acetamide (PubChem CID 88800520) has the molecular formula C9H8Cl3NO and a molecular weight of 252.53 g/mol. Its IUPAC name is N-(2,3,4-trichloro-6-methylphenyl)acetamide.
| Compound Name | N-(2,3,4-trichloro-6-methylphenyl)acetamide |
|---|---|
| PubChem CID | 88800520 |
| Molecular Formula | C9H8Cl3NO |
| Molecular Weight | 252.53 g/mol |
| Exact Mass | 250.97 |
| IUPAC Name | N-(2,3,4-trichloro-6-methylphenyl)acetamide |
| SMILES | CC(=O)Nc1c(C)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C9H8Cl3NO/c1-4-3-6(10)7(11)8(12)9(4)13-5(2)14/h3H,1-2H3,(H,13,14) |
| InChIKey | PVHXMYOUIMWNJA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|