C11H15NO2 — CID 168944592
N-[4-(hydroxymethyl)-2,6-dimethylphenyl]acetamide (PubChem CID 168944592) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is N-[4-(hydroxymethyl)-2,6-dimethylphenyl]acetamide.
| Compound Name | N-[4-(hydroxymethyl)-2,6-dimethylphenyl]acetamide |
|---|---|
| PubChem CID | 168944592 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | N-[4-(hydroxymethyl)-2,6-dimethylphenyl]acetamide |
| SMILES | CC(=O)Nc1c(C)cc(CO)cc1C |
| InChI | InChI=1S/C11H15NO2/c1-7-4-10(6-13)5-8(2)11(7)12-9(3)14/h4-5,13H,6H2,1-3H3,(H,12,14) |
| InChIKey | WQHIRQIRCKRXAO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |