C12H18ClNO — CID 156737682
N-(4-chloro-2,6-dimethylphenyl)acetamide;ethane (PubChem CID 156737682) has the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. Its IUPAC name is N-(4-chloro-2,6-dimethylphenyl)acetamide;ethane.
| Compound Name | N-(4-chloro-2,6-dimethylphenyl)acetamide;ethane |
|---|---|
| PubChem CID | 156737682 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.73 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-(4-chloro-2,6-dimethylphenyl)acetamide;ethane |
| SMILES | CC.CC(=O)Nc1c(C)cc(Cl)cc1C |
| InChI | InChI=1S/C10H12ClNO.C2H6/c1-6-4-9(11)5-7(2)10(6)12-8(3)13;1-2/h4-5H,1-3H3,(H,12,13);1-2H3 |
| InChIKey | AWMNRTRKVYCUGL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.73 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |