C18H30ClNOPY+ — CID 160515011
[1-(4-chloro-2,6-dimethylanilino)-1-oxobutan-2-yl]-triethylphosphanium;yttrium (PubChem CID 160515011) has the molecular formula C18H30ClNOPY+ and a molecular weight of 431.78 g/mol. Its IUPAC name is [1-(4-chloro-2,6-dimethylanilino)-1-oxobutan-2-yl]-triethylphosphanium;yttrium.
| Compound Name | [1-(4-chloro-2,6-dimethylanilino)-1-oxobutan-2-yl]-triethylphosphanium;yttrium |
|---|---|
| PubChem CID | 160515011 |
| Molecular Formula | C18H30ClNOPY+ |
| Molecular Weight | 431.78 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | [1-(4-chloro-2,6-dimethylanilino)-1-oxobutan-2-yl]-triethylphosphanium;yttrium |
| SMILES | CCC(C(=O)Nc1c(C)cc(Cl)cc1C)[P+](CC)(CC)CC.[Y] |
| InChI | InChI=1S/C18H29ClNOP.Y/c1-7-16(22(8-2,9-3)10-4)18(21)20-17-13(5)11-15(19)12-14(17)6;/h11-12,16H,7-10H2,1-6H3;/p+1 |
| InChIKey | JUCXSOSKUJYZSI-UHFFFAOYSA-O |
| XLogP | 5.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.78 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|