C19H30ClN2O+ — CID 159712870
N-(4-chloro-2,6-dimethylphenyl)-2-(1-ethylazepan-1-ium-1-yl)propanamide (PubChem CID 159712870) has the molecular formula C19H30ClN2O+ and a molecular weight of 337.92 g/mol. Its IUPAC name is N-(4-chloro-2,6-dimethylphenyl)-2-(1-ethylazepan-1-ium-1-yl)propanamide.
| Compound Name | N-(4-chloro-2,6-dimethylphenyl)-2-(1-ethylazepan-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 159712870 |
| Molecular Formula | C19H30ClN2O+ |
| Molecular Weight | 337.92 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | N-(4-chloro-2,6-dimethylphenyl)-2-(1-ethylazepan-1-ium-1-yl)propanamide |
| SMILES | CC[N+]1(C(C)C(=O)Nc2c(C)cc(Cl)cc2C)CCCCCC1 |
| InChI | InChI=1S/C19H29ClN2O/c1-5-22(10-8-6-7-9-11-22)16(4)19(23)21-18-14(2)12-17(20)13-15(18)3/h12-13,16H,5-11H2,1-4H3/p+1 |
| InChIKey | GHWANXXNXKBAFP-UHFFFAOYSA-O |
| XLogP | 4.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.92 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|