C18H26N3OY+ — CID 162256206
N-(4-cyano-2,6-dimethylphenyl)-2-(1-ethylpyrrolidin-1-ium-1-yl)propanamide;yttrium (PubChem CID 162256206) has the molecular formula C18H26N3OY+ and a molecular weight of 389.33 g/mol. Its IUPAC name is N-(4-cyano-2,6-dimethylphenyl)-2-(1-ethylpyrrolidin-1-ium-1-yl)propanamide;yttrium.
| Compound Name | N-(4-cyano-2,6-dimethylphenyl)-2-(1-ethylpyrrolidin-1-ium-1-yl)propanamide;yttrium |
|---|---|
| PubChem CID | 162256206 |
| Molecular Formula | C18H26N3OY+ |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-(4-cyano-2,6-dimethylphenyl)-2-(1-ethylpyrrolidin-1-ium-1-yl)propanamide;yttrium |
| SMILES | CC[N+]1(C(C)C(=O)Nc2c(C)cc(C#N)cc2C)CCCC1.[Y] |
| InChI | InChI=1S/C18H25N3O.Y/c1-5-21(8-6-7-9-21)15(4)18(22)20-17-13(2)10-16(12-19)11-14(17)3;/h10-11,15H,5-9H2,1-4H3;/p+1 |
| InChIKey | DZTQOZNTTPOMCG-UHFFFAOYSA-O |
| XLogP | 3.13 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|