C20H30N3O+ — CID 155692392
N-(4-cyano-2,6-dimethylphenyl)-2-(1-methylpiperidin-1-ium-1-yl)pentanamide (PubChem CID 155692392) has the molecular formula C20H30N3O+ and a molecular weight of 328.48 g/mol. Its IUPAC name is N-(4-cyano-2,6-dimethylphenyl)-2-(1-methylpiperidin-1-ium-1-yl)pentanamide.
| Compound Name | N-(4-cyano-2,6-dimethylphenyl)-2-(1-methylpiperidin-1-ium-1-yl)pentanamide |
|---|---|
| PubChem CID | 155692392 |
| Molecular Formula | C20H30N3O+ |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | N-(4-cyano-2,6-dimethylphenyl)-2-(1-methylpiperidin-1-ium-1-yl)pentanamide |
| SMILES | CCCC(C(=O)Nc1c(C)cc(C#N)cc1C)[N+]1(C)CCCCC1 |
| InChI | InChI=1S/C20H29N3O/c1-5-9-18(23(4)10-7-6-8-11-23)20(24)22-19-15(2)12-17(14-21)13-16(19)3/h12-13,18H,5-11H2,1-4H3/p+1 |
| InChIKey | SFLUUBGPLPGPHU-UHFFFAOYSA-O |
| XLogP | 3.91 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|