C21H33N2O3+ — CID 157148530
methyl 2-[2-(1-ethylpyrrolidin-1-ium-1-yl)pentanoylamino]-3,5-dimethylbenzoate (PubChem CID 157148530) has the molecular formula C21H33N2O3+ and a molecular weight of 361.51 g/mol. Its IUPAC name is methyl 2-[2-(1-ethylpyrrolidin-1-ium-1-yl)pentanoylamino]-3,5-dimethylbenzoate.
| Compound Name | methyl 2-[2-(1-ethylpyrrolidin-1-ium-1-yl)pentanoylamino]-3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 157148530 |
| Molecular Formula | C21H33N2O3+ |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | methyl 2-[2-(1-ethylpyrrolidin-1-ium-1-yl)pentanoylamino]-3,5-dimethylbenzoate |
| SMILES | CCCC(C(=O)Nc1c(C)cc(C)cc1C(=O)OC)[N+]1(CC)CCCC1 |
| InChI | InChI=1S/C21H32N2O3/c1-6-10-18(23(7-2)11-8-9-12-23)20(24)22-19-16(4)13-15(3)14-17(19)21(25)26-5/h13-14,18H,6-12H2,1-5H3/p+1 |
| InChIKey | XNWOYDYGIHJQPH-UHFFFAOYSA-O |
| XLogP | 3.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|