C17H27N2O3+ — CID 155693036
[1-(2-methoxycarbonyl-4,6-dimethylanilino)-1-oxobutan-2-yl]-trimethylazanium (PubChem CID 155693036) has the molecular formula C17H27N2O3+ and a molecular weight of 307.41 g/mol. Its IUPAC name is [1-(2-methoxycarbonyl-4,6-dimethylanilino)-1-oxobutan-2-yl]-trimethylazanium.
| Compound Name | [1-(2-methoxycarbonyl-4,6-dimethylanilino)-1-oxobutan-2-yl]-trimethylazanium |
|---|---|
| PubChem CID | 155693036 |
| Molecular Formula | C17H27N2O3+ |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | [1-(2-methoxycarbonyl-4,6-dimethylanilino)-1-oxobutan-2-yl]-trimethylazanium |
| SMILES | CCC(C(=O)Nc1c(C)cc(C)cc1C(=O)OC)[N+](C)(C)C |
| InChI | InChI=1S/C17H26N2O3/c1-8-14(19(4,5)6)16(20)18-15-12(3)9-11(2)10-13(15)17(21)22-7/h9-10,14H,8H2,1-7H3/p+1 |
| InChIKey | VZPVZRBYRJALNF-UHFFFAOYSA-O |
| XLogP | 2.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|