C19H31N2O3+ — CID 155693040
diethyl-[1-(2-methoxycarbonyl-4,6-dimethylanilino)-1-oxobutan-2-yl]-methylazanium (PubChem CID 155693040) has the molecular formula C19H31N2O3+ and a molecular weight of 335.47 g/mol. Its IUPAC name is diethyl-[1-(2-methoxycarbonyl-4,6-dimethylanilino)-1-oxobutan-2-yl]-methylazanium.
| Compound Name | diethyl-[1-(2-methoxycarbonyl-4,6-dimethylanilino)-1-oxobutan-2-yl]-methylazanium |
|---|---|
| PubChem CID | 155693040 |
| Molecular Formula | C19H31N2O3+ |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | diethyl-[1-(2-methoxycarbonyl-4,6-dimethylanilino)-1-oxobutan-2-yl]-methylazanium |
| SMILES | CCC(C(=O)Nc1c(C)cc(C)cc1C(=O)OC)[N+](C)(CC)CC |
| InChI | InChI=1S/C19H30N2O3/c1-8-16(21(6,9-2)10-3)18(22)20-17-14(5)11-13(4)12-15(17)19(23)24-7/h11-12,16H,8-10H2,1-7H3/p+1 |
| InChIKey | ZSKWCWUXTTYNHF-UHFFFAOYSA-O |
| XLogP | 3.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|