C26H34ClN2O5+ — CID 170269688
[1-(4-chloro-2-methoxycarbonyl-6-methylanilino)-1-oxobutan-2-yl]-diethyl-(2-oxo-2-phenylmethoxyethyl)azanium (PubChem CID 170269688) has the molecular formula C26H34ClN2O5+ and a molecular weight of 490.02 g/mol. Its IUPAC name is [1-(4-chloro-2-methoxycarbonyl-6-methylanilino)-1-oxobutan-2-yl]-diethyl-(2-oxo-2-phenylmethoxyethyl)azanium.
| Compound Name | [1-(4-chloro-2-methoxycarbonyl-6-methylanilino)-1-oxobutan-2-yl]-diethyl-(2-oxo-2-phenylmethoxyethyl)azanium |
|---|---|
| PubChem CID | 170269688 |
| Molecular Formula | C26H34ClN2O5+ |
| Molecular Weight | 490.02 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | [1-(4-chloro-2-methoxycarbonyl-6-methylanilino)-1-oxobutan-2-yl]-diethyl-(2-oxo-2-phenylmethoxyethyl)azanium |
| SMILES | CCC(C(=O)Nc1c(C)cc(Cl)cc1C(=O)OC)[N+](CC)(CC)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H33ClN2O5/c1-6-22(25(31)28-24-18(4)14-20(27)15-21(24)26(32)33-5)29(7-2,8-3)16-23(30)34-17-19-12-10-9-11-13-19/h9-15,22H,6-8,16-17H2,1-5H3/p+1 |
| InChIKey | QJFDRHQVEJDZGN-UHFFFAOYSA-O |
| XLogP | 4.75 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.02 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|