C25H32ClN2O5+ — CID 170269884
[2-(4-chloro-2-ethoxycarbonyl-6-methylanilino)-2-oxoethyl]-diethyl-(2-oxo-2-phenylmethoxyethyl)azanium (PubChem CID 170269884) has the molecular formula C25H32ClN2O5+ and a molecular weight of 475.99 g/mol. Its IUPAC name is [2-(4-chloro-2-ethoxycarbonyl-6-methylanilino)-2-oxoethyl]-diethyl-(2-oxo-2-phenylmethoxyethyl)azanium.
| Compound Name | [2-(4-chloro-2-ethoxycarbonyl-6-methylanilino)-2-oxoethyl]-diethyl-(2-oxo-2-phenylmethoxyethyl)azanium |
|---|---|
| PubChem CID | 170269884 |
| Molecular Formula | C25H32ClN2O5+ |
| Molecular Weight | 475.99 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | [2-(4-chloro-2-ethoxycarbonyl-6-methylanilino)-2-oxoethyl]-diethyl-(2-oxo-2-phenylmethoxyethyl)azanium |
| SMILES | CCOC(=O)c1cc(Cl)cc(C)c1NC(=O)C[N+](CC)(CC)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H31ClN2O5/c1-5-28(6-2,16-23(30)33-17-19-11-9-8-10-12-19)15-22(29)27-24-18(4)13-20(26)14-21(24)25(31)32-7-3/h8-14H,5-7,15-17H2,1-4H3/p+1 |
| InChIKey | DIBCCGSVEAXZIB-UHFFFAOYSA-O |
| XLogP | 4.36 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.99 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|