C25H32FN2O5+ — CID 170269682
diethyl-[1-(4-fluoro-2-methoxycarbonyl-6-methylanilino)-1-oxopropan-2-yl]-(2-oxo-2-phenylmethoxyethyl)azanium (PubChem CID 170269682) has the molecular formula C25H32FN2O5+ and a molecular weight of 459.54 g/mol. Its IUPAC name is diethyl-[1-(4-fluoro-2-methoxycarbonyl-6-methylanilino)-1-oxopropan-2-yl]-(2-oxo-2-phenylmethoxyethyl)azanium.
| Compound Name | diethyl-[1-(4-fluoro-2-methoxycarbonyl-6-methylanilino)-1-oxopropan-2-yl]-(2-oxo-2-phenylmethoxyethyl)azanium |
|---|---|
| PubChem CID | 170269682 |
| Molecular Formula | C25H32FN2O5+ |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | diethyl-[1-(4-fluoro-2-methoxycarbonyl-6-methylanilino)-1-oxopropan-2-yl]-(2-oxo-2-phenylmethoxyethyl)azanium |
| SMILES | CC[N+](CC)(CC(=O)OCc1ccccc1)C(C)C(=O)Nc1c(C)cc(F)cc1C(=O)OC |
| InChI | InChI=1S/C25H31FN2O5/c1-6-28(7-2,15-22(29)33-16-19-11-9-8-10-12-19)18(4)24(30)27-23-17(3)13-20(26)14-21(23)25(31)32-5/h8-14,18H,6-7,15-16H2,1-5H3/p+1 |
| InChIKey | DONSOMZRVDQCTE-UHFFFAOYSA-O |
| XLogP | 3.85 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|