C28H39N2O5+ — CID 170269686
diethyl-[1-(2-methoxycarbonyl-4,6-dimethylanilino)-1-oxopentan-2-yl]-(2-oxo-2-phenylmethoxyethyl)azanium (PubChem CID 170269686) has the molecular formula C28H39N2O5+ and a molecular weight of 483.63 g/mol. Its IUPAC name is diethyl-[1-(2-methoxycarbonyl-4,6-dimethylanilino)-1-oxopentan-2-yl]-(2-oxo-2-phenylmethoxyethyl)azanium.
| Compound Name | diethyl-[1-(2-methoxycarbonyl-4,6-dimethylanilino)-1-oxopentan-2-yl]-(2-oxo-2-phenylmethoxyethyl)azanium |
|---|---|
| PubChem CID | 170269686 |
| Molecular Formula | C28H39N2O5+ |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | diethyl-[1-(2-methoxycarbonyl-4,6-dimethylanilino)-1-oxopentan-2-yl]-(2-oxo-2-phenylmethoxyethyl)azanium |
| SMILES | CCCC(C(=O)Nc1c(C)cc(C)cc1C(=O)OC)[N+](CC)(CC)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H38N2O5/c1-7-13-24(27(32)29-26-21(5)16-20(4)17-23(26)28(33)34-6)30(8-2,9-3)18-25(31)35-19-22-14-11-10-12-15-22/h10-12,14-17,24H,7-9,13,18-19H2,1-6H3/p+1 |
| InChIKey | BFBLQAUXFYAANZ-UHFFFAOYSA-O |
| XLogP | 4.80 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|