C27H37N2O5+ — CID 170269871
[1-(2-ethoxycarbonyl-4,6-dimethylanilino)-1-oxopropan-2-yl]-diethyl-(2-oxo-2-phenylmethoxyethyl)azanium (PubChem CID 170269871) has the molecular formula C27H37N2O5+ and a molecular weight of 469.60 g/mol. Its IUPAC name is [1-(2-ethoxycarbonyl-4,6-dimethylanilino)-1-oxopropan-2-yl]-diethyl-(2-oxo-2-phenylmethoxyethyl)azanium.
| Compound Name | [1-(2-ethoxycarbonyl-4,6-dimethylanilino)-1-oxopropan-2-yl]-diethyl-(2-oxo-2-phenylmethoxyethyl)azanium |
|---|---|
| PubChem CID | 170269871 |
| Molecular Formula | C27H37N2O5+ |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | [1-(2-ethoxycarbonyl-4,6-dimethylanilino)-1-oxopropan-2-yl]-diethyl-(2-oxo-2-phenylmethoxyethyl)azanium |
| SMILES | CCOC(=O)c1cc(C)cc(C)c1NC(=O)C(C)[N+](CC)(CC)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H36N2O5/c1-7-29(8-2,17-24(30)34-18-22-13-11-10-12-14-22)21(6)26(31)28-25-20(5)15-19(4)16-23(25)27(32)33-9-3/h10-16,21H,7-9,17-18H2,1-6H3/p+1 |
| InChIKey | PCAZZCYOQCRMNN-UHFFFAOYSA-O |
| XLogP | 4.41 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|