C28H35N2O5+ — CID 170269795
ethyl 3,5-dimethyl-2-[[1-[1-(2-oxo-2-phenylmethoxyethyl)pyrrolidin-1-ium-1-yl]cyclopropanecarbonyl]amino]benzoate (PubChem CID 170269795) has the molecular formula C28H35N2O5+ and a molecular weight of 479.60 g/mol. Its IUPAC name is ethyl 3,5-dimethyl-2-[[1-[1-(2-oxo-2-phenylmethoxyethyl)pyrrolidin-1-ium-1-yl]cyclopropanecarbonyl]amino]benzoate.
| Compound Name | ethyl 3,5-dimethyl-2-[[1-[1-(2-oxo-2-phenylmethoxyethyl)pyrrolidin-1-ium-1-yl]cyclopropanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 170269795 |
| Molecular Formula | C28H35N2O5+ |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | ethyl 3,5-dimethyl-2-[[1-[1-(2-oxo-2-phenylmethoxyethyl)pyrrolidin-1-ium-1-yl]cyclopropanecarbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(C)cc(C)c1NC(=O)C1([N+]2(CC(=O)OCc3ccccc3)CCCC2)CC1 |
| InChI | InChI=1S/C28H34N2O5/c1-4-34-26(32)23-17-20(2)16-21(3)25(23)29-27(33)28(12-13-28)30(14-8-9-15-30)18-24(31)35-19-22-10-6-5-7-11-22/h5-7,10-11,16-17H,4,8-9,12-15,18-19H2,1-3H3/p+1 |
| InChIKey | YTKCUUMLICCVNY-UHFFFAOYSA-O |
| XLogP | 4.31 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|