C29H36FN2O5+ — CID 170269760
ethyl 5-fluoro-3-methyl-2-[[1-[1-(2-oxo-2-phenylmethoxyethyl)azepan-1-ium-1-yl]cyclopropanecarbonyl]amino]benzoate (PubChem CID 170269760) has the molecular formula C29H36FN2O5+ and a molecular weight of 511.61 g/mol. Its IUPAC name is ethyl 5-fluoro-3-methyl-2-[[1-[1-(2-oxo-2-phenylmethoxyethyl)azepan-1-ium-1-yl]cyclopropanecarbonyl]amino]benzoate.
| Compound Name | ethyl 5-fluoro-3-methyl-2-[[1-[1-(2-oxo-2-phenylmethoxyethyl)azepan-1-ium-1-yl]cyclopropanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 170269760 |
| Molecular Formula | C29H36FN2O5+ |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | ethyl 5-fluoro-3-methyl-2-[[1-[1-(2-oxo-2-phenylmethoxyethyl)azepan-1-ium-1-yl]cyclopropanecarbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(F)cc(C)c1NC(=O)C1([N+]2(CC(=O)OCc3ccccc3)CCCCCC2)CC1 |
| InChI | InChI=1S/C29H35FN2O5/c1-3-36-27(34)24-18-23(30)17-21(2)26(24)31-28(35)29(13-14-29)32(15-9-4-5-10-16-32)19-25(33)37-20-22-11-7-6-8-12-22/h6-8,11-12,17-18H,3-5,9-10,13-16,19-20H2,1-2H3/p+1 |
| InChIKey | SSYHOGQZGRYRGR-UHFFFAOYSA-O |
| XLogP | 4.92 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|