C27H34FN2O5+ — CID 170269875
[1-[(2-ethoxycarbonyl-4-fluoro-6-methylphenyl)carbamoyl]cyclopropyl]-diethyl-(2-oxo-2-phenylmethoxyethyl)azanium (PubChem CID 170269875) has the molecular formula C27H34FN2O5+ and a molecular weight of 485.58 g/mol. Its IUPAC name is [1-[(2-ethoxycarbonyl-4-fluoro-6-methylphenyl)carbamoyl]cyclopropyl]-diethyl-(2-oxo-2-phenylmethoxyethyl)azanium.
| Compound Name | [1-[(2-ethoxycarbonyl-4-fluoro-6-methylphenyl)carbamoyl]cyclopropyl]-diethyl-(2-oxo-2-phenylmethoxyethyl)azanium |
|---|---|
| PubChem CID | 170269875 |
| Molecular Formula | C27H34FN2O5+ |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | [1-[(2-ethoxycarbonyl-4-fluoro-6-methylphenyl)carbamoyl]cyclopropyl]-diethyl-(2-oxo-2-phenylmethoxyethyl)azanium |
| SMILES | CCOC(=O)c1cc(F)cc(C)c1NC(=O)C1([N+](CC)(CC)CC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C27H33FN2O5/c1-5-30(6-2,17-23(31)35-18-20-11-9-8-10-12-20)27(13-14-27)26(33)29-24-19(4)15-21(28)16-22(24)25(32)34-7-3/h8-12,15-16H,5-7,13-14,17-18H2,1-4H3/p+1 |
| InChIKey | PVQFODDCEPRJSG-UHFFFAOYSA-O |
| XLogP | 4.38 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|