C31H41N2O5+ — CID 170269752
ethyl 3,5-dimethyl-2-[[1-[1-(2-oxo-2-phenylmethoxyethyl)azepan-1-ium-1-yl]cyclobutanecarbonyl]amino]benzoate (PubChem CID 170269752) has the molecular formula C31H41N2O5+ and a molecular weight of 521.68 g/mol. Its IUPAC name is ethyl 3,5-dimethyl-2-[[1-[1-(2-oxo-2-phenylmethoxyethyl)azepan-1-ium-1-yl]cyclobutanecarbonyl]amino]benzoate.
| Compound Name | ethyl 3,5-dimethyl-2-[[1-[1-(2-oxo-2-phenylmethoxyethyl)azepan-1-ium-1-yl]cyclobutanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 170269752 |
| Molecular Formula | C31H41N2O5+ |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | ethyl 3,5-dimethyl-2-[[1-[1-(2-oxo-2-phenylmethoxyethyl)azepan-1-ium-1-yl]cyclobutanecarbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(C)cc(C)c1NC(=O)C1([N+]2(CC(=O)OCc3ccccc3)CCCCCC2)CCC1 |
| InChI | InChI=1S/C31H40N2O5/c1-4-37-29(35)26-20-23(2)19-24(3)28(26)32-30(36)31(15-12-16-31)33(17-10-5-6-11-18-33)21-27(34)38-22-25-13-8-7-9-14-25/h7-9,13-14,19-20H,4-6,10-12,15-18,21-22H2,1-3H3/p+1 |
| InChIKey | RPUILCISMUKJBS-UHFFFAOYSA-O |
| XLogP | 5.48 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|