C23H35N2O3+ — CID 155693088
ethyl 3,5-dimethyl-2-[[1-(1-methylazepan-1-ium-1-yl)cyclobutanecarbonyl]amino]benzoate (PubChem CID 155693088) has the molecular formula C23H35N2O3+ and a molecular weight of 387.54 g/mol. Its IUPAC name is ethyl 3,5-dimethyl-2-[[1-(1-methylazepan-1-ium-1-yl)cyclobutanecarbonyl]amino]benzoate.
| Compound Name | ethyl 3,5-dimethyl-2-[[1-(1-methylazepan-1-ium-1-yl)cyclobutanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 155693088 |
| Molecular Formula | C23H35N2O3+ |
| Molecular Weight | 387.54 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | ethyl 3,5-dimethyl-2-[[1-(1-methylazepan-1-ium-1-yl)cyclobutanecarbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(C)cc(C)c1NC(=O)C1([N+]2(C)CCCCCC2)CCC1 |
| InChI | InChI=1S/C23H34N2O3/c1-5-28-21(26)19-16-17(2)15-18(3)20(19)24-22(27)23(11-10-12-23)25(4)13-8-6-7-9-14-25/h15-16H,5-14H2,1-4H3/p+1 |
| InChIKey | XFTNVMCJJJXDAB-UHFFFAOYSA-O |
| XLogP | 4.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|