C21H31N2O4+ — CID 155693045
ethyl 5-methoxy-3-methyl-2-[[1-(1-methylpiperidin-1-ium-1-yl)cyclopropanecarbonyl]amino]benzoate (PubChem CID 155693045) has the molecular formula C21H31N2O4+ and a molecular weight of 375.49 g/mol. Its IUPAC name is ethyl 5-methoxy-3-methyl-2-[[1-(1-methylpiperidin-1-ium-1-yl)cyclopropanecarbonyl]amino]benzoate.
| Compound Name | ethyl 5-methoxy-3-methyl-2-[[1-(1-methylpiperidin-1-ium-1-yl)cyclopropanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 155693045 |
| Molecular Formula | C21H31N2O4+ |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | ethyl 5-methoxy-3-methyl-2-[[1-(1-methylpiperidin-1-ium-1-yl)cyclopropanecarbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(OC)cc(C)c1NC(=O)C1([N+]2(C)CCCCC2)CC1 |
| InChI | InChI=1S/C21H30N2O4/c1-5-27-19(24)17-14-16(26-4)13-15(2)18(17)22-20(25)21(9-10-21)23(3)11-7-6-8-12-23/h13-14H,5-12H2,1-4H3/p+1 |
| InChIKey | SZWZUJWYZMXKNG-UHFFFAOYSA-O |
| XLogP | 3.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|