C20H29N2O3+ — CID 155692835
methyl 3-methyl-2-[[1-(1-methylazepan-1-ium-1-yl)cyclopropanecarbonyl]amino]benzoate (PubChem CID 155692835) has the molecular formula C20H29N2O3+ and a molecular weight of 345.46 g/mol. Its IUPAC name is methyl 3-methyl-2-[[1-(1-methylazepan-1-ium-1-yl)cyclopropanecarbonyl]amino]benzoate.
| Compound Name | methyl 3-methyl-2-[[1-(1-methylazepan-1-ium-1-yl)cyclopropanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 155692835 |
| Molecular Formula | C20H29N2O3+ |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | methyl 3-methyl-2-[[1-(1-methylazepan-1-ium-1-yl)cyclopropanecarbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(C)c1NC(=O)C1([N+]2(C)CCCCCC2)CC1 |
| InChI | InChI=1S/C20H28N2O3/c1-15-9-8-10-16(18(23)25-3)17(15)21-19(24)20(11-12-20)22(2)13-6-4-5-7-14-22/h8-10H,4-7,11-14H2,1-3H3/p+1 |
| InChIKey | RIKMIMOKIDAWGT-UHFFFAOYSA-O |
| XLogP | 3.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|