C24H31BrN2O3 — CID 155098868
methyl 2-[[2-(1-benzylazepan-1-ium-1-yl)acetyl]amino]-3-methylbenzoate bromide (PubChem CID 155098868) has the molecular formula C24H31BrN2O3 and a molecular weight of 475.43 g/mol. Its IUPAC name is methyl 2-[[2-(1-benzylazepan-1-ium-1-yl)acetyl]amino]-3-methylbenzoate bromide.
| Compound Name | methyl 2-[[2-(1-benzylazepan-1-ium-1-yl)acetyl]amino]-3-methylbenzoate bromide |
|---|---|
| PubChem CID | 155098868 |
| Molecular Formula | C24H31BrN2O3 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | methyl 2-[[2-(1-benzylazepan-1-ium-1-yl)acetyl]amino]-3-methylbenzoate bromide |
| SMILES | COC(=O)c1cccc(C)c1NC(=O)C[N+]1(Cc2ccccc2)CCCCCC1.[Br-] |
| InChI | InChI=1S/C24H30N2O3.BrH/c1-19-11-10-14-21(24(28)29-2)23(19)25-22(27)18-26(15-8-3-4-9-16-26)17-20-12-6-5-7-13-20;/h5-7,10-14H,3-4,8-9,15-18H2,1-2H3;1H |
| InChIKey | IOFQZBHVMUZKDT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|