C22H29BrN2O — CID 159015876
2-(1-benzylazepan-1-ium-1-yl)-N-(2-methylphenyl)acetamide bromide (PubChem CID 159015876) has the molecular formula C22H29BrN2O and a molecular weight of 417.39 g/mol. Its IUPAC name is 2-(1-benzylazepan-1-ium-1-yl)-N-(2-methylphenyl)acetamide bromide.
| Compound Name | 2-(1-benzylazepan-1-ium-1-yl)-N-(2-methylphenyl)acetamide bromide |
|---|---|
| PubChem CID | 159015876 |
| Molecular Formula | C22H29BrN2O |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 2-(1-benzylazepan-1-ium-1-yl)-N-(2-methylphenyl)acetamide bromide |
| SMILES | Cc1ccccc1NC(=O)C[N+]1(Cc2ccccc2)CCCCCC1.[Br-] |
| InChI | InChI=1S/C22H28N2O.BrH/c1-19-11-7-8-14-21(19)23-22(25)18-24(15-9-2-3-10-16-24)17-20-12-5-4-6-13-20;/h4-8,11-14H,2-3,9-10,15-18H2,1H3;1H |
| InChIKey | NFRGMKSFNXSKIO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|