C27H38N2O3 — CID 160996445
2-(1-benzylazepan-1-ium-1-yl)-N-(4-pentylphenyl)acetamide formate (PubChem CID 160996445) has the molecular formula C27H38N2O3 and a molecular weight of 438.61 g/mol. Its IUPAC name is 2-(1-benzylazepan-1-ium-1-yl)-N-(4-pentylphenyl)acetamide formate.
| Compound Name | 2-(1-benzylazepan-1-ium-1-yl)-N-(4-pentylphenyl)acetamide formate |
|---|---|
| PubChem CID | 160996445 |
| Molecular Formula | C27H38N2O3 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | 2-(1-benzylazepan-1-ium-1-yl)-N-(4-pentylphenyl)acetamide formate |
| SMILES | CCCCCc1ccc(NC(=O)C[N+]2(Cc3ccccc3)CCCCCC2)cc1.O=C[O-] |
| InChI | InChI=1S/C26H36N2O.CH2O2/c1-2-3-7-12-23-15-17-25(18-16-23)27-26(29)22-28(19-10-4-5-11-20-28)21-24-13-8-6-9-14-24;2-1-3/h6,8-9,13-18H,2-5,7,10-12,19-22H2,1H3;1H,(H,2,3) |
| InChIKey | TVHRWACAFAIHCP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|