C25H35N2O+ — CID 155615086
2-(1-benzylazepan-1-ium-1-yl)-N-(2-methyl-6-propan-2-ylphenyl)acetamide (PubChem CID 155615086) has the molecular formula C25H35N2O+ and a molecular weight of 379.57 g/mol. Its IUPAC name is 2-(1-benzylazepan-1-ium-1-yl)-N-(2-methyl-6-propan-2-ylphenyl)acetamide.
| Compound Name | 2-(1-benzylazepan-1-ium-1-yl)-N-(2-methyl-6-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 155615086 |
| Molecular Formula | C25H35N2O+ |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | 2-(1-benzylazepan-1-ium-1-yl)-N-(2-methyl-6-propan-2-ylphenyl)acetamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)C[N+]1(Cc2ccccc2)CCCCCC1 |
| InChI | InChI=1S/C25H34N2O/c1-20(2)23-15-11-12-21(3)25(23)26-24(28)19-27(16-9-4-5-10-17-27)18-22-13-7-6-8-14-22/h6-8,11-15,20H,4-5,9-10,16-19H2,1-3H3/p+1 |
| InChIKey | NTKOAUYBYMIDDP-UHFFFAOYSA-O |
| XLogP | 5.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|