C29H35N2O+ — CID 155615730
2-(1-benzyl-3-phenylazepan-1-ium-1-yl)-N-(2,6-dimethylphenyl)acetamide (PubChem CID 155615730) has the molecular formula C29H35N2O+ and a molecular weight of 427.61 g/mol. Its IUPAC name is 2-(1-benzyl-3-phenylazepan-1-ium-1-yl)-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-(1-benzyl-3-phenylazepan-1-ium-1-yl)-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 155615730 |
| Molecular Formula | C29H35N2O+ |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | 2-(1-benzyl-3-phenylazepan-1-ium-1-yl)-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)C[N+]1(Cc2ccccc2)CCCCC(c2ccccc2)C1 |
| InChI | InChI=1S/C29H34N2O/c1-23-12-11-13-24(2)29(23)30-28(32)22-31(20-25-14-5-3-6-15-25)19-10-9-18-27(21-31)26-16-7-4-8-17-26/h3-8,11-17,27H,9-10,18-22H2,1-2H3/p+1 |
| InChIKey | PGLAIBCZSVRABE-UHFFFAOYSA-O |
| XLogP | 6.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|