C23H30N3O2+ — CID 155615700
2-[1-[2-(2,6-dimethylanilino)-2-oxoethyl]-3-phenylpiperidin-1-ium-1-yl]acetamide (PubChem CID 155615700) has the molecular formula C23H30N3O2+ and a molecular weight of 380.51 g/mol. Its IUPAC name is 2-[1-[2-(2,6-dimethylanilino)-2-oxoethyl]-3-phenylpiperidin-1-ium-1-yl]acetamide.
| Compound Name | 2-[1-[2-(2,6-dimethylanilino)-2-oxoethyl]-3-phenylpiperidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 155615700 |
| Molecular Formula | C23H30N3O2+ |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 2-[1-[2-(2,6-dimethylanilino)-2-oxoethyl]-3-phenylpiperidin-1-ium-1-yl]acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)C[N+]1(CC(N)=O)CCCC(c2ccccc2)C1 |
| InChI | InChI=1S/C23H29N3O2/c1-17-8-6-9-18(2)23(17)25-22(28)16-26(15-21(24)27)13-7-12-20(14-26)19-10-4-3-5-11-19/h3-6,8-11,20H,7,12-16H2,1-2H3,(H2-,24,25,27,28)/p+1 |
| InChIKey | VEMKMMCRCMZDFO-UHFFFAOYSA-O |
| XLogP | 3.12 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|